C42H32IrN3 — CID 59800942
iridium(3+);bis(2-phenylpyridine);2-[3-(4-prop-2-enylphenyl)benzene-6-id-1-yl]pyridine (PubChem CID 59800942) has the molecular formula C42H32IrN3 and a molecular weight of 770.96 g/mol. Its IUPAC name is iridium(3+);bis(2-phenylpyridine);2-[3-(4-prop-2-enylphenyl)benzene-6-id-1-yl]pyridine.
| Compound Name | iridium(3+);bis(2-phenylpyridine);2-[3-(4-prop-2-enylphenyl)benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 59800942 |
| Molecular Formula | C42H32IrN3 |
| Molecular Weight | 770.96 g/mol |
| Exact Mass | 771.22 |
| IUPAC Name | iridium(3+);bis(2-phenylpyridine);2-[3-(4-prop-2-enylphenyl)benzene-6-id-1-yl]pyridine |
| SMILES | C=CCc1ccc(-c2cc[c-]c(-c3ccccn3)c2)cc1.[Ir+3].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C20H16N.2C11H8N.Ir/c1-2-6-16-10-12-17(13-11-16)18-7-5-8-19(15-18)20-9-3-4-14-21-20;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-5,7,9-15H,1,6H2;2*1-6,8-9H;/q3*-1;+3 |
| InChIKey | QTJQNEVZNWKLDI-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.96 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|