C41H28IrN- — CID 171461304
iridium;2-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine (PubChem CID 171461304) has the molecular formula C41H28IrN- and a molecular weight of 726.90 g/mol. Its IUPAC name is iridium;2-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine.
| Compound Name | iridium;2-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 171461304 |
| Molecular Formula | C41H28IrN- |
| Molecular Weight | 726.90 g/mol |
| Exact Mass | 727.19 |
| IUPAC Name | iridium;2-[3-[3-[3-[3-(3-phenylphenyl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine |
| SMILES | [Ir].[c-]1ccc(-c2cccc(-c3cccc(-c4cccc(-c5cccc(-c6ccccc6)c5)c4)c3)c2)cc1-c1ccccn1 |
| InChI | InChI=1S/C41H28N.Ir/c1-2-11-30(12-3-1)31-13-6-14-32(25-31)33-15-7-16-34(26-33)35-17-8-18-36(27-35)37-19-9-20-38(28-37)39-21-10-22-40(29-39)41-23-4-5-24-42-41;/h1-21,23-29H;/q-1; |
| InChIKey | ZHYAZWFNJOTNRC-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.90 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|