C85H100IrN- — CID 140720975
2-[3-[3,5-bis[3,5-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine;iridium (PubChem CID 140720975) has the molecular formula C85H100IrN- and a molecular weight of 1327.96 g/mol. Its IUPAC name is 2-[3-[3,5-bis[3,5-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine;iridium.
| Compound Name | 2-[3-[3,5-bis[3,5-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine;iridium |
|---|---|
| PubChem CID | 140720975 |
| Molecular Formula | C85H100IrN- |
| Molecular Weight | 1327.96 g/mol |
| Exact Mass | 1327.75 |
| IUPAC Name | 2-[3-[3,5-bis[3,5-bis[4-(2,4,4-trimethylpentan-2-yl)phenyl]phenyl]phenyl]benzene-6-id-1-yl]pyridine;iridium |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(-c2cc(-c3ccc(C(C)(C)CC(C)(C)C)cc3)cc(-c3cc(-c4cc[c-]c(-c5ccccn5)c4)cc(-c4cc(-c5ccc(C(C)(C)CC(C)(C)C)cc5)cc(-c5ccc(C(C)(C)CC(C)(C)C)cc5)c4)c3)c2)cc1.[Ir] |
| InChI | InChI=1S/C85H100N.Ir/c1-78(2,3)54-82(13,14)73-35-27-58(28-36-73)64-45-65(59-29-37-74(38-30-59)83(15,16)55-79(4,5)6)48-69(47-64)71-51-68(62-24-23-25-63(44-62)77-26-21-22-43-86-77)52-72(53-71)70-49-66(60-31-39-75(40-32-60)84(17,18)56-80(7,8)9)46-67(50-70)61-33-41-76(42-34-61)85(19,20)57-81(10,11)12;/h21-24,26-53H,54-57H2,1-20H3;/q-1; |
| InChIKey | APZXCTIXFQJCOC-UHFFFAOYSA-N |
| XLogP | 25.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1327.96 |
| LogP ≤ 5 | 25.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|