C42H36IrN2-2 — CID 168745330
4-tert-butyl-2-[3-(3,5-dimethylphenyl)benzene-6-id-1-yl]pyridine;iridium;2-(2H-phenanthren-2-id-3-yl)pyridine (PubChem CID 168745330) has the molecular formula C42H36IrN2-2 and a molecular weight of 760.98 g/mol. Its IUPAC name is 4-tert-butyl-2-[3-(3,5-dimethylphenyl)benzene-6-id-1-yl]pyridine;iridium;2-(2H-phenanthren-2-id-3-yl)pyridine.
| Compound Name | 4-tert-butyl-2-[3-(3,5-dimethylphenyl)benzene-6-id-1-yl]pyridine;iridium;2-(2H-phenanthren-2-id-3-yl)pyridine |
|---|---|
| PubChem CID | 168745330 |
| Molecular Formula | C42H36IrN2-2 |
| Molecular Weight | 760.98 g/mol |
| Exact Mass | 761.25 |
| IUPAC Name | 4-tert-butyl-2-[3-(3,5-dimethylphenyl)benzene-6-id-1-yl]pyridine;iridium;2-(2H-phenanthren-2-id-3-yl)pyridine |
| SMILES | Cc1cc(C)cc(-c2cc[c-]c(-c3cc(C(C)(C)C)ccn3)c2)c1.[Ir].[c-]1cc2ccc3ccccc3c2cc1-c1ccccn1 |
| InChI | InChI=1S/C23H24N.C19H12N.Ir/c1-16-11-17(2)13-20(12-16)18-7-6-8-19(14-18)22-15-21(9-10-24-22)23(3,4)5;1-2-6-17-14(5-1)8-9-15-10-11-16(13-18(15)17)19-7-3-4-12-20-19;/h6-7,9-15H,1-5H3;1-10,12-13H;/q2*-1; |
| InChIKey | HNSHPLLTFRGDIU-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.98 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|