C40H32IrN2-2 — CID 164792237
4-(1,1-dideuterio-2-methylpropyl)-2-(3H-phenanthren-3-id-2-yl)pyridine;iridium;2-(3-phenylbenzene-6-id-1-yl)pyridine (PubChem CID 164792237) has the molecular formula C40H32IrN2-2 and a molecular weight of 734.94 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2-methylpropyl)-2-(3H-phenanthren-3-id-2-yl)pyridine;iridium;2-(3-phenylbenzene-6-id-1-yl)pyridine.
| Compound Name | 4-(1,1-dideuterio-2-methylpropyl)-2-(3H-phenanthren-3-id-2-yl)pyridine;iridium;2-(3-phenylbenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 164792237 |
| Molecular Formula | C40H32IrN2-2 |
| Molecular Weight | 734.94 g/mol |
| Exact Mass | 735.23 |
| IUPAC Name | 4-(1,1-dideuterio-2-methylpropyl)-2-(3H-phenanthren-3-id-2-yl)pyridine;iridium;2-(3-phenylbenzene-6-id-1-yl)pyridine |
| SMILES | [2H]C([2H])(c1ccnc(-c2[c-]cc3c(ccc4ccccc43)c2)c1)C(C)C.[Ir].[c-]1ccc(-c2ccccc2)cc1-c1ccccn1 |
| InChI | InChI=1S/C23H20N.C17H12N.Ir/c1-16(2)13-17-11-12-24-23(14-17)20-9-10-22-19(15-20)8-7-18-5-3-4-6-21(18)22;1-2-7-14(8-3-1)15-9-6-10-16(13-15)17-11-4-5-12-18-17;/h3-8,10-12,14-16H,13H2,1-2H3;1-9,11-13H;/q2*-1;/i13D2;; |
| InChIKey | ODRUNRWLHSHAJX-DKGKLUEFSA-N |
| XLogP | 10.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.94 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|