C41H34IrN2-2 — CID 172506649
4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(4-phenanthren-9-ylbenzene-6-id-1-yl)pyridine;iridium;2-phenylpyridine (PubChem CID 172506649) has the molecular formula C41H34IrN2-2 and a molecular weight of 748.97 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(4-phenanthren-9-ylbenzene-6-id-1-yl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(4-phenanthren-9-ylbenzene-6-id-1-yl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 172506649 |
| Molecular Formula | C41H34IrN2-2 |
| Molecular Weight | 748.97 g/mol |
| Exact Mass | 749.25 |
| IUPAC Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(4-phenanthren-9-ylbenzene-6-id-1-yl)pyridine;iridium;2-phenylpyridine |
| SMILES | [2H]C([2H])(c1ccnc(-c2[c-]cc(-c3cc4ccccc4c4ccccc34)cc2)c1)C(C)(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C30H26N.C11H8N.Ir/c1-30(2,3)20-21-16-17-31-29(18-21)23-14-12-22(13-15-23)28-19-24-8-4-5-9-25(24)26-10-6-7-11-27(26)28;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-14,16-19H,20H2,1-3H3;1-6,8-9H;/q2*-1;/i20D2;; |
| InChIKey | FOLVQHPIEIPKHY-ACYVRODMSA-N |
| XLogP | 10.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.97 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|