C40H36IrN2-2 — CID 162709631
4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(4-phenylbenzene-6-id-1-yl)pyridine;4-[dideuterio(phenyl)methyl]-2-phenylpyridine;iridium (PubChem CID 162709631) has the molecular formula C40H36IrN2-2 and a molecular weight of 740.98 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(4-phenylbenzene-6-id-1-yl)pyridine;4-[dideuterio(phenyl)methyl]-2-phenylpyridine;iridium.
| Compound Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(4-phenylbenzene-6-id-1-yl)pyridine;4-[dideuterio(phenyl)methyl]-2-phenylpyridine;iridium |
|---|---|
| PubChem CID | 162709631 |
| Molecular Formula | C40H36IrN2-2 |
| Molecular Weight | 740.98 g/mol |
| Exact Mass | 741.28 |
| IUPAC Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(4-phenylbenzene-6-id-1-yl)pyridine;4-[dideuterio(phenyl)methyl]-2-phenylpyridine;iridium |
| SMILES | [2H]C([2H])(c1ccccc1)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])(c1ccnc(-c2[c-]cc(-c3ccccc3)cc2)c1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C22H22N.C18H14N.Ir/c1-22(2,3)16-17-13-14-23-21(15-17)20-11-9-19(10-12-20)18-7-5-4-6-8-18;1-3-7-15(8-4-1)13-16-11-12-19-18(14-16)17-9-5-2-6-10-17;/h4-11,13-15H,16H2,1-3H3;1-9,11-12,14H,13H2;/q2*-1;/i16D2;13D2; |
| InChIKey | MMBGORZIJWXCRE-VTQQGWRRSA-N |
| XLogP | 9.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.98 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|