C40H31IrN3O-2 — CID 162777253
CID 162777253 (PubChem CID 162777253) has the molecular formula C40H31IrN3O-2 and a molecular weight of 763.94 g/mol.
| Compound Name | CID 162777253 |
|---|---|
| PubChem CID | 162777253 |
| Molecular Formula | C40H31IrN3O-2 |
| Molecular Weight | 763.94 g/mol |
| Exact Mass | 764.22 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1ccnc(-c2[c-]cc3cnc4cccc5oc2c3c45)c1)C(C)(C)C.[Ir].[c-]1ccccc1-c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C23H19N2O.C17H12N.Ir/c1-23(2,3)12-14-9-10-24-18(11-14)16-8-7-15-13-25-17-5-4-6-19-21(17)20(15)22(16)26-19;1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15;/h4-7,9-11,13H,12H2,1-3H3;1-9,11-13H;/q2*-1;/i12D2;; |
| InChIKey | OWIKZJVEJMYJOJ-ZGJYSPQCSA-N |
| XLogP | 10.24 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.94 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|