C51H39IrN3O-2 — CID 166044021
CID 166044021 (PubChem CID 166044021) has the molecular formula C51H39IrN3O-2 and a molecular weight of 904.12 g/mol.
| Compound Name | CID 166044021 |
|---|---|
| PubChem CID | 166044021 |
| Molecular Formula | C51H39IrN3O-2 |
| Molecular Weight | 904.12 g/mol |
| Exact Mass | 904.29 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])(c1ccc(-c2ccnc(-c3[c-]ccc4c3oc3ccc5c(c6ccccc6n5-c5ccccc5)c34)c2)cc1)C(C)(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C40H31N2O.C11H8N.Ir/c1-40(2,3)25-26-16-18-27(19-17-26)28-22-23-41-33(24-28)30-13-9-14-32-38-36(43-39(30)32)21-20-35-37(38)31-12-7-8-15-34(31)42(35)29-10-5-4-6-11-29;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-12,14-24H,25H2,1-3H3;1-6,8-9H;/q2*-1;/i25D2;; |
| InChIKey | QVDBDWQHCZCIPR-LNWRQOIUSA-N |
| XLogP | 13.35 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.12 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|