C53H43IrN3O-2 — CID 166043896
CID 166043896 (PubChem CID 166043896) has the molecular formula C53H43IrN3O-2 and a molecular weight of 938.21 g/mol.
| Compound Name | CID 166043896 |
|---|---|
| PubChem CID | 166043896 |
| Molecular Formula | C53H43IrN3O-2 |
| Molecular Weight | 938.21 g/mol |
| Exact Mass | 938.35 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])[2H])cn2)cc1.[2H]C([2H])(c1ccc(-c2ccnc(-c3[c-]ccc4c3oc3ccc5c(c6ccccc6n5-c5ccccc5)c34)c2)cc1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C40H31N2O.C13H12N.Ir/c1-40(2,3)25-26-16-18-27(19-17-26)28-22-23-41-33(24-28)30-13-9-14-32-38-36(43-39(30)32)21-20-35-37(38)31-12-7-8-15-34(31)42(35)29-10-5-4-6-11-29;1-10-3-6-12(7-4-10)13-8-5-11(2)9-14-13;/h4-12,14-24H,25H2,1-3H3;3-6,8-9H,1-2H3;/q2*-1;/i25D2;1D3,2D3; |
| InChIKey | JUAUAQIUSHDDAJ-ODECCZGXSA-N |
| XLogP | 13.96 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.21 |
| LogP ≤ 5 | 13.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|