C52H47IrN3O-2 — CID 166044054
CID 166044054 (PubChem CID 166044054) has the molecular formula C52H47IrN3O-2 and a molecular weight of 929.23 g/mol.
| Compound Name | CID 166044054 |
|---|---|
| PubChem CID | 166044054 |
| Molecular Formula | C52H47IrN3O-2 |
| Molecular Weight | 929.23 g/mol |
| Exact Mass | 929.38 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])C(C)(C)C)cn2)cc1.[2H]C([2H])(c1ccc(-c2ccnc(-c3[c-]ccc4c3oc3cc5c(ccc6ccccc65)cc34)c2)nc1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C35H27N2O.C17H20N.Ir/c1-35(2,3)20-22-11-14-31(37-21-22)25-15-16-36-32(18-25)28-10-6-9-27-30-17-24-13-12-23-7-4-5-8-26(23)29(24)19-33(30)38-34(27)28;1-13-5-8-15(9-6-13)16-10-7-14(12-18-16)11-17(2,3)4;/h4-9,11-19,21H,20H2,1-3H3;5-8,10,12H,11H2,1-4H3;/q2*-1;/i20D2;1D3,11D2; |
| InChIKey | WWGQATCCAKWGMA-HMSCCWMQSA-N |
| XLogP | 13.85 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.23 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|