C59H64IrN2O-2 — CID 153450247
CID 153450247 (PubChem CID 153450247) has the molecular formula C59H64IrN2O-2 and a molecular weight of 1020.46 g/mol.
| Compound Name | CID 153450247 |
|---|---|
| PubChem CID | 153450247 |
| Molecular Formula | C59H64IrN2O-2 |
| Molecular Weight | 1020.46 g/mol |
| Exact Mass | 1020.53 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C([2H])([2H])C(C)(C)C)cn2)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5cc(C6([2H])CCC7(CCCCC7)CC6)ccc54)cc23)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C42H44NO.C17H20N.Ir/c1-27-26-43-38(23-32(27)25-41(2,3)4)35-10-8-9-34-37-22-31-12-11-30-21-29(13-14-33(30)36(31)24-39(37)44-40(34)35)28-15-19-42(20-16-28)17-6-5-7-18-42;1-13-5-8-15(9-6-13)16-10-7-14(12-18-16)11-17(2,3)4;/h8-9,11-14,21-24,26,28H,5-7,15-20,25H2,1-4H3;5-8,10,12H,11H2,1-4H3;/q2*-1;/i1D3,25D2,28D;1D3,11D2; |
| InChIKey | KAQCMPBRKQWEDX-HGZOMTQGSA-N |
| XLogP | 16.70 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.46 |
| LogP ≤ 5 | 16.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|