C52H51IrN3O-2 — CID 176624387
CID 176624387 (PubChem CID 176624387) has the molecular formula C52H51IrN3O-2 and a molecular weight of 933.26 g/mol.
| Compound Name | CID 176624387 |
|---|---|
| PubChem CID | 176624387 |
| Molecular Formula | C52H51IrN3O-2 |
| Molecular Weight | 933.26 g/mol |
| Exact Mass | 933.41 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2nccc(C(C)(C)C)n2)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C1([2H])CCC2(CCCCC2)CC1.[Ir] |
| InChI | InChI=1S/C37H34NO.C15H17N2.Ir/c1-24-23-38-34(21-31(24)26-14-18-37(19-15-26)16-5-2-6-17-37)30-11-7-10-29-33-20-27-13-12-25-8-3-4-9-28(25)32(27)22-35(33)39-36(29)30;1-11-5-7-12(8-6-11)14-16-10-9-13(17-14)15(2,3)4;/h3-4,7-10,12-13,20-23,26H,2,5-6,14-19H2,1H3;5-7,9-10H,1-4H3;/q2*-1;/i1D3,26D;1D3; |
| InChIKey | FDJSWIWPAMYWDJ-VSSSLOHOSA-N |
| XLogP | 14.22 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.26 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|