C55H56IrN2O-2 — CID 176624334
CID 176624334 (PubChem CID 176624334) has the molecular formula C55H56IrN2O-2 and a molecular weight of 960.33 g/mol.
| Compound Name | CID 176624334 |
|---|---|
| PubChem CID | 176624334 |
| Molecular Formula | C55H56IrN2O-2 |
| Molecular Weight | 960.33 g/mol |
| Exact Mass | 960.45 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(C(C)(C)C)ccn2)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C1([2H])CCC2(CCC(C)(C)CC2)CC1.[Ir] |
| InChI | InChI=1S/C39H38NO.C16H18N.Ir/c1-25-24-40-35(22-32(25)27-13-15-39(16-14-27)19-17-38(2,3)18-20-39)31-10-6-9-30-34-21-28-12-11-26-7-4-5-8-29(26)33(28)23-36(34)41-37(30)31;1-12-5-7-13(8-6-12)15-11-14(9-10-17-15)16(2,3)4;/h4-9,11-12,21-24,27H,13-20H2,1-3H3;5-7,9-11H,1-4H3;/q2*-1;/i1D3,27D;1D3; |
| InChIKey | RJOAOMLNHYOLTQ-FIMOSUOHSA-N |
| XLogP | 15.46 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.33 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|