About CID 176624417
CID 176624417 (PubChem CID 176624417) has the molecular formula C55H56IrN2O-2
and a molecular weight of 960.33 g/mol.
Molecular Properties
| Compound Name | CID 176624417 |
| PubChem CID | 176624417 |
| Molecular Formula | C55H56IrN2O-2 |
| Molecular Weight | 960.33 g/mol |
| Exact Mass | 960.45 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C1([2H])CCC2(CCC(C)(C)CC2)CC1.[2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1C(C)(C)C.[Ir] |
| InChI | InChI=1S/C39H38NO.C16H18N.Ir/c1-25-24-40-35(22-32(25)27-13-15-39(16-14-27)19-17-38(2,3)18-20-39)31-10-6-9-30-34-21-28-12-11-26-7-4-5-8-29(26)33(28)23-36(34)41-37(30)31;1-12-11-17-15(10-14(12)16(2,3)4)13-8-6-5-7-9-13;/h4-9,11-12,21-24,27H,13-20H2,1-3H3;5-8,10-11H,1-4H3;/q2*-1;/i1D3,27D;1D3; |
| InChIKey | QZFIMSBRHLEQBD-FIMOSUOHSA-N |
| XLogP | 15.46 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 960.33 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176624417 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176624417?
The IUPAC name of CID 176624417 (CID 176624417) is not available.
What is the SMILES notation for CID 176624417?
The canonical SMILES for CID 176624417 is [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C1([2H])CCC2(CCC(C)(C)CC2)CC1.[2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1C(C)(C)C.[Ir].
What is the InChIKey of CID 176624417?
The InChIKey is QZFIMSBRHLEQBD-FIMOSUOHSA-N. The full InChI is InChI=1S/C39H38NO.C16H18N.Ir/c1-25-24-40-35(22-32(25)27-13-15-39(16-14-27)19-17-38(2,3)18-20-39)31-10-6-9-30-34-21-28-12-11-26-7-4-5-8-29(26)33(28)23-36(34)41-37(30)31;1-12-11-17-15(10-14(12)16(2,3)4)13-8-6-5-7-9-13;/h4-9,11-12,21-24,27H,13-20H2,1-3H3;5-8,10-11H,1-4H3;/q2*-1;/i1D3,27D;1D3;.
What are the key properties of CID 176624417?
CID 176624417 has a molecular weight of 960.33 g/mol, XLogP of 15.46, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176624417 is sourced from PubChem (CID 176624417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).