C45H42GeIrN2O-2 — CID 176623932
CID 176623932 (PubChem CID 176623932) has the molecular formula C45H42GeIrN2O-2 and a molecular weight of 897.71 g/mol.
| Compound Name | CID 176623932 |
|---|---|
| PubChem CID | 176623932 |
| Molecular Formula | C45H42GeIrN2O-2 |
| Molecular Weight | 897.71 g/mol |
| Exact Mass | 899.25 |
| IUPAC Name | — |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]c1nc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc(C([2H])([2H])C(C)(C)C)c1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C31H26NO.C14H16GeN.Ir/c1-19-18-32-28(15-22(19)17-31(2,3)4)25-11-7-10-24-27-14-21-13-12-20-8-5-6-9-23(20)26(21)16-29(27)33-30(24)25;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h5-10,12-16,18H,17H2,1-4H3;4-7,9-11H,1-3H3;/q2*-1;/i1D3,17D2,18D;; |
| InChIKey | QJUWTGIPOWQVID-UVENRRRMSA-N |
| XLogP | 11.74 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.71 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|