C43H36IrN2O-2 — CID 177109120
5-(1,1-dideuterio-2,2-dimethylpropyl)-2-phenylpyridine;iridium;2-(9H-phenanthro[1,2-b][1]benzofuran-9-id-10-yl)-4,5-bis(trideuteriomethyl)pyridine (PubChem CID 177109120) has the molecular formula C43H36IrN2O-2 and a molecular weight of 797.04 g/mol. Its IUPAC name is 5-(1,1-dideuterio-2,2-dimethylpropyl)-2-phenylpyridine;iridium;2-(9H-phenanthro[1,2-b][1]benzofuran-9-id-10-yl)-4,5-bis(trideuteriomethyl)pyridine.
| Compound Name | 5-(1,1-dideuterio-2,2-dimethylpropyl)-2-phenylpyridine;iridium;2-(9H-phenanthro[1,2-b][1]benzofuran-9-id-10-yl)-4,5-bis(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 177109120 |
| Molecular Formula | C43H36IrN2O-2 |
| Molecular Weight | 797.04 g/mol |
| Exact Mass | 797.30 |
| IUPAC Name | 5-(1,1-dideuterio-2,2-dimethylpropyl)-2-phenylpyridine;iridium;2-(9H-phenanthro[1,2-b][1]benzofuran-9-id-10-yl)-4,5-bis(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2c3ccc3c4ccccc4ccc32)cc1C([2H])([2H])[2H].[2H]C([2H])(c1ccc(-c2[c-]cccc2)nc1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C27H18NO.C16H18N.Ir/c1-16-14-25(28-15-17(16)2)24-9-5-8-21-23-13-12-20-19-7-4-3-6-18(19)10-11-22(20)26(23)29-27(21)24;1-16(2,3)11-13-9-10-15(17-12-13)14-7-5-4-6-8-14;/h3-8,10-15H,1-2H3;4-7,9-10,12H,11H2,1-3H3;/q2*-1;/i1D3,2D3;11D2; |
| InChIKey | ZVTFZAXBMSTSLA-WVGKVSBUSA-N |
| XLogP | 11.51 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.04 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|