C54H54IrN2O2-2 — CID 153490160
CID 153490160 (PubChem CID 153490160) has the molecular formula C54H54IrN2O2-2 and a molecular weight of 964.31 g/mol.
| Compound Name | CID 153490160 |
|---|---|
| PubChem CID | 153490160 |
| Molecular Formula | C54H54IrN2O2-2 |
| Molecular Weight | 964.31 g/mol |
| Exact Mass | 964.44 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(cc23)oc2c3ccccc3ccc42)cc1C([2H])([2H])C(C)(C)C.[2H]C([2H])(c1cnc(-c2[c-]cccc2)cc1C([2H])([2H])C(C)(C)C)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C33H26NO2.C21H28N.Ir/c1-19-18-34-28(14-21(19)17-33(2,3)4)25-11-7-10-23-26-15-30-27(16-29(26)36-32(23)25)24-13-12-20-8-5-6-9-22(20)31(24)35-30;1-20(2,3)13-17-12-19(16-10-8-7-9-11-16)22-15-18(17)14-21(4,5)6;/h5-10,12-16,18H,17H2,1-4H3;7-10,12,15H,13-14H2,1-6H3;/q2*-1;/i1D3,17D2;13D2,14D2; |
| InChIKey | VCFVFUKZMOWTRV-NMPUTMIUSA-N |
| XLogP | 15.12 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.31 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|