About CID 176814932
CID 176814932 (PubChem CID 176814932) has the molecular formula C57H53IrN3O-2
and a molecular weight of 993.32 g/mol.
Molecular Properties
| Compound Name | CID 176814932 |
| PubChem CID | 176814932 |
| Molecular Formula | C57H53IrN3O-2 |
| Molecular Weight | 993.32 g/mol |
| Exact Mass | 993.41 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(C)C)c(-n2c(-c3[c-]cccc3)nc3ccccc32)c(C(C)C)c1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C31H26NO.C26H27N2.Ir/c1-19-18-32-28(15-22(19)17-31(2,3)4)25-11-7-10-24-27-14-21-13-12-20-8-5-6-9-23(20)26(21)16-29(27)33-30(24)25;1-17(2)21-15-19(5)16-22(18(3)4)25(21)28-24-14-10-9-13-23(24)27-26(28)20-11-7-6-8-12-20;/h5-10,12-16,18H,17H2,1-4H3;6-11,13-18H,1-5H3;/q2*-1;/i1D3,17D2;; |
| InChIKey | JJCXKNLBSLBRHT-SWTWTNFSSA-N |
| XLogP | 15.70 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 993.32 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176814932 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176814932?
The IUPAC name of CID 176814932 (CID 176814932) is not available.
What is the SMILES notation for CID 176814932?
The canonical SMILES for CID 176814932 is Cc1cc(C(C)C)c(-n2c(-c3[c-]cccc3)nc3ccccc32)c(C(C)C)c1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C([2H])([2H])C(C)(C)C.[Ir].
What is the InChIKey of CID 176814932?
The InChIKey is JJCXKNLBSLBRHT-SWTWTNFSSA-N. The full InChI is InChI=1S/C31H26NO.C26H27N2.Ir/c1-19-18-32-28(15-22(19)17-31(2,3)4)25-11-7-10-24-27-14-21-13-12-20-8-5-6-9-23(20)26(21)16-29(27)33-30(24)25;1-17(2)21-15-19(5)16-22(18(3)4)25(21)28-24-14-10-9-13-23(24)27-26(28)20-11-7-6-8-12-20;/h5-10,12-16,18H,17H2,1-4H3;6-11,13-18H,1-5H3;/q2*-1;/i1D3,17D2;;.
What are the key properties of CID 176814932?
CID 176814932 has a molecular weight of 993.32 g/mol, XLogP of 15.70, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176814932 is sourced from PubChem (CID 176814932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).