C60H61IrN3OSi-2 — CID 156659672
CID 156659672 (PubChem CID 156659672) has the molecular formula C60H61IrN3OSi-2 and a molecular weight of 1061.48 g/mol.
| Compound Name | CID 156659672 |
|---|---|
| PubChem CID | 156659672 |
| Molecular Formula | C60H61IrN3OSi-2 |
| Molecular Weight | 1061.48 g/mol |
| Exact Mass | 1061.43 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(C)(C)C)cc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)nc2ccccc21.[2H]C(C)(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C43H39N2O.C17H22NSi.Ir/c1-25(2)33-22-29(43(5,6)7)23-34(26(3)4)40(33)45-38-18-11-10-17-37(38)44-42(45)32-16-12-15-31-36-21-28-20-19-27-13-8-9-14-30(27)35(28)24-39(36)46-41(31)32;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h8-15,17-26H,1-7H3;6-9,11-13H,1-5H3;/q2*-1;/i;13D; |
| InChIKey | FQYPQULZRUVDBF-LTBAMTPYSA-N |
| XLogP | 16.46 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.48 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|