C52H57IrN3OSi-2 — CID 156660679
2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]benzimidazole;[4-(3,3-dimethylpentan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 156660679) has the molecular formula C52H57IrN3OSi-2 and a molecular weight of 960.35 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]benzimidazole;[4-(3,3-dimethylpentan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]benzimidazole;[4-(3,3-dimethylpentan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 156660679 |
| Molecular Formula | C52H57IrN3OSi-2 |
| Molecular Weight | 960.35 g/mol |
| Exact Mass | 960.39 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]benzimidazole;[4-(3,3-dimethylpentan-2-yl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2ccccc23)nc2ccccc21.CCC(C)(C)C(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir] |
| InChI | InChI=1S/C31H27N2O.C21H30NSi.Ir/c1-19(2)21-12-9-13-22(20(3)4)29(21)33-27-17-7-6-16-26(27)32-31(33)25-15-10-14-24-23-11-5-8-18-28(23)34-30(24)25;1-8-21(3,4)16(2)18-14-19(17-12-10-9-11-13-17)22-15-20(18)23(5,6)7;/h5-14,16-20H,1-4H3;9-12,14-16H,8H2,1-7H3;/q2*-1; |
| InChIKey | LVRKCMNVJBQBEL-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.35 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|