C56H59GeIrN3O-2 — CID 156659708
[4-(2-adamantylmethyl)-6-phenyl-3-pyridinyl]-trimethylgermane;2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]benzimidazole;iridium (PubChem CID 156659708) has the molecular formula C56H59GeIrN3O-2 and a molecular weight of 1054.93 g/mol. Its IUPAC name is [4-(2-adamantylmethyl)-6-phenyl-3-pyridinyl]-trimethylgermane;2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]benzimidazole;iridium.
| Compound Name | [4-(2-adamantylmethyl)-6-phenyl-3-pyridinyl]-trimethylgermane;2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]benzimidazole;iridium |
|---|---|
| PubChem CID | 156659708 |
| Molecular Formula | C56H59GeIrN3O-2 |
| Molecular Weight | 1054.93 g/mol |
| Exact Mass | 1056.35 |
| IUPAC Name | [4-(2-adamantylmethyl)-6-phenyl-3-pyridinyl]-trimethylgermane;2-(3H-dibenzofuran-3-id-4-yl)-1-[2,6-di(propan-2-yl)phenyl]benzimidazole;iridium |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2ccccc23)nc2ccccc21.C[Ge](C)(C)c1cnc(-c2[c-]cccc2)cc1CC1C2CC3CC(C2)CC1C3.[Ir] |
| InChI | InChI=1S/C31H27N2O.C25H32GeN.Ir/c1-19(2)21-12-9-13-22(20(3)4)29(21)33-27-17-7-6-16-26(27)32-31(33)25-15-10-14-24-23-11-5-8-18-28(23)34-30(24)25;1-26(2,3)24-16-27-25(19-7-5-4-6-8-19)15-22(24)14-23-20-10-17-9-18(12-20)13-21(23)11-17;/h5-14,16-20H,1-4H3;4-7,15-18,20-21,23H,9-14H2,1-3H3;/q2*-1; |
| InChIKey | FMDPLVIHDHBRAF-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.93 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|