C50H43GeIrN3O2-2 — CID 162776775
2-(3H-dibenzofuran-3-id-4-yl)-1-dibenzofuran-4-ylbenzimidazole;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium (PubChem CID 162776775) has the molecular formula C50H43GeIrN3O2-2 and a molecular weight of 982.74 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-1-dibenzofuran-4-ylbenzimidazole;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-dibenzofuran-4-ylbenzimidazole;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
|---|---|
| PubChem CID | 162776775 |
| Molecular Formula | C50H43GeIrN3O2-2 |
| Molecular Weight | 982.74 g/mol |
| Exact Mass | 984.22 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-dibenzofuran-4-ylbenzimidazole;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
| SMILES | CC(C)(C)Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir].[c-]1ccc2c(oc3ccccc32)c1-c1nc2ccccc2n1-c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C31H17N2O2.C19H26GeN.Ir/c1-5-17-27-19(9-1)21-11-7-13-23(29(21)34-27)31-32-24-14-3-4-15-25(24)33(31)26-16-8-12-22-20-10-2-6-18-28(20)35-30(22)26;1-19(2,3)13-16-12-18(15-10-8-7-9-11-15)21-14-17(16)20(4,5)6;/h1-12,14-18H;7-10,12,14H,13H2,1-6H3;/q2*-1; |
| InChIKey | XTNOPEGSMPIOQQ-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.74 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|