C55H47GeIrN3O-2 — CID 156658017
2-(3H-dibenzofuran-3-id-4-yl)-1-(2,5-diphenylphenyl)benzimidazole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium (PubChem CID 156658017) has the molecular formula C55H47GeIrN3O-2 and a molecular weight of 1032.84 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-1-(2,5-diphenylphenyl)benzimidazole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-(2,5-diphenylphenyl)benzimidazole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
|---|---|
| PubChem CID | 156658017 |
| Molecular Formula | C55H47GeIrN3O-2 |
| Molecular Weight | 1032.84 g/mol |
| Exact Mass | 1034.27 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-(2,5-diphenylphenyl)benzimidazole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
| SMILES | [2H]C([2H])(c1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C)C(C)C.[Ir].[c-]1ccc2c(oc3ccccc32)c1-c1nc2ccccc2n1-c1cc(-c2ccccc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C37H23N2O.C18H24GeN.Ir/c1-3-12-25(13-4-1)27-22-23-28(26-14-5-2-6-15-26)34(24-27)39-33-20-9-8-19-32(33)38-37(39)31-18-11-17-30-29-16-7-10-21-35(29)40-36(30)31;1-14(2)11-16-12-18(15-9-7-6-8-10-15)20-13-17(16)19(3,4)5;/h1-17,19-24H;6-9,12-14H,11H2,1-5H3;/q2*-1;/i;11D2; |
| InChIKey | RHZKILZRJINMJP-YXZWVCJGSA-N |
| XLogP | 14.02 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.84 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|