C39H39GeIrN3O-2 — CID 156659628
2-(3H-dibenzofuran-3-id-4-yl)-1-ethylbenzimidazole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium (PubChem CID 156659628) has the molecular formula C39H39GeIrN3O-2 and a molecular weight of 832.60 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-1-ethylbenzimidazole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-ethylbenzimidazole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
|---|---|
| PubChem CID | 156659628 |
| Molecular Formula | C39H39GeIrN3O-2 |
| Molecular Weight | 832.60 g/mol |
| Exact Mass | 834.21 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-ethylbenzimidazole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
| SMILES | CCn1c(-c2[c-]ccc3c2oc2ccccc23)nc2ccccc21.[2H]C([2H])(c1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C)C(C)C.[Ir] |
| InChI | InChI=1S/C21H15N2O.C18H24GeN.Ir/c1-2-23-18-12-5-4-11-17(18)22-21(23)16-10-7-9-15-14-8-3-6-13-19(14)24-20(15)16;1-14(2)11-16-12-18(15-9-7-6-8-10-15)20-13-17(16)19(3,4)5;/h3-9,11-13H,2H2,1H3;6-9,12-14H,11H2,1-5H3;/q2*-1;/i;11D2; |
| InChIKey | WVBQSGARXLKIET-YXZWVCJGSA-N |
| XLogP | 9.71 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.60 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|