C50H42GeIrN2O2-2 — CID 166498811
2-(3H-dibenzofuran-3-id-4-yl)-3-dibenzofuran-4-yl-3H-indole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium (PubChem CID 166498811) has the molecular formula C50H42GeIrN2O2-2 and a molecular weight of 969.74 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-3-dibenzofuran-4-yl-3H-indole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-dibenzofuran-4-yl-3H-indole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
|---|---|
| PubChem CID | 166498811 |
| Molecular Formula | C50H42GeIrN2O2-2 |
| Molecular Weight | 969.74 g/mol |
| Exact Mass | 971.22 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-dibenzofuran-4-yl-3H-indole;[4-(1,1-dideuterio-2-methylpropyl)-6-phenyl-3-pyridinyl]-trimethylgermane;iridium |
| SMILES | [2H]C([2H])(c1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C)C(C)C.[Ir].[c-]1ccc2c(oc3ccccc32)c1C1=Nc2ccccc2C1c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C32H18NO2.C18H24GeN.Ir/c1-4-16-26-23(11-1)29(24-14-7-12-21-19-9-2-5-17-27(19)34-31(21)24)30(33-26)25-15-8-13-22-20-10-3-6-18-28(20)35-32(22)25;1-14(2)11-16-12-18(15-9-7-6-8-10-15)20-13-17(16)19(3,4)5;/h1-14,16-18,29H;6-9,12-14H,11H2,1-5H3;/q2*-1;/i;11D2; |
| InChIKey | WYDUGOGRWIJCJY-YXZWVCJGSA-N |
| XLogP | 12.84 |
| TPSA | 51.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.74 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|