C47H46IrN2OSi-2 — CID 166499399
2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(2-ethyl-2-methylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 166499399) has the molecular formula C47H46IrN2OSi-2 and a molecular weight of 875.20 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(2-ethyl-2-methylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(2-ethyl-2-methylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 166499399 |
| Molecular Formula | C47H46IrN2OSi-2 |
| Molecular Weight | 875.20 g/mol |
| Exact Mass | 875.30 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(2-ethyl-2-methylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CCC(C)(CC)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir].[c-]1ccc2c(oc3ccccc32)c1C1=Nc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C26H16NO.C21H30NSi.Ir/c1-2-9-17(10-3-1)24-20-12-4-6-15-22(20)27-25(24)21-14-8-13-19-18-11-5-7-16-23(18)28-26(19)21;1-7-21(3,8-2)15-18-14-19(17-12-10-9-11-13-17)22-16-20(18)23(4,5)6;/h1-13,15-16,24H;9-12,14,16H,7-8,15H2,1-6H3;/q2*-1; |
| InChIKey | MYGAQXRJBDKKHQ-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.20 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|