C46H44IrN2OSi-2 — CID 166499078
2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(2-ethylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 166499078) has the molecular formula C46H44IrN2OSi-2 and a molecular weight of 861.17 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(2-ethylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(2-ethylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 166499078 |
| Molecular Formula | C46H44IrN2OSi-2 |
| Molecular Weight | 861.17 g/mol |
| Exact Mass | 861.29 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(2-ethylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CCC(CC)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir].[c-]1ccc2c(oc3ccccc32)c1C1=Nc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C26H16NO.C20H28NSi.Ir/c1-2-9-17(10-3-1)24-20-12-4-6-15-22(20)27-25(24)21-14-8-13-19-18-11-5-7-16-23(18)28-26(19)21;1-6-16(7-2)13-18-14-19(17-11-9-8-10-12-17)21-15-20(18)22(3,4)5;/h1-13,15-16,24H;8-11,14-16H,6-7,13H2,1-5H3;/q2*-1; |
| InChIKey | WHDKQBTZTTZLRO-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.17 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|