C56H56GeIrN2O-2 — CID 166499012
2-(3H-dibenzofuran-3-id-4-yl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]-3H-indole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane (PubChem CID 166499012) has the molecular formula C56H56GeIrN2O-2 and a molecular weight of 1037.90 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]-3H-indole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]-3H-indole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane |
|---|---|
| PubChem CID | 166499012 |
| Molecular Formula | C56H56GeIrN2O-2 |
| Molecular Weight | 1037.90 g/mol |
| Exact Mass | 1039.32 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-[4-phenyl-2,6-di(propan-2-yl)phenyl]-3H-indole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]germane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1C1C(c2[c-]ccc3c2oc2ccccc23)=Nc2ccccc21.[Ir] |
| InChI | InChI=1S/C38H32NO.C18H24GeN.Ir/c1-23(2)31-21-26(25-13-6-5-7-14-25)22-32(24(3)4)35(31)36-29-16-8-10-19-33(29)39-37(36)30-18-12-17-28-27-15-9-11-20-34(27)40-38(28)30;1-14(2)11-16-12-18(15-9-7-6-8-10-15)20-13-17(16)19(3,4)5;/h5-17,19-24,36H,1-4H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | BLSPWTUNWVVGJL-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.90 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|