C46H44IrN2OSi-2 — CID 166499265
2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(1,1-dideuterio-2,2-dimethylpropyl)-6-phenyl-2-(trideuteriomethyl)-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 166499265) has the molecular formula C46H44IrN2OSi-2 and a molecular weight of 866.20 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(1,1-dideuterio-2,2-dimethylpropyl)-6-phenyl-2-(trideuteriomethyl)-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(1,1-dideuterio-2,2-dimethylpropyl)-6-phenyl-2-(trideuteriomethyl)-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 166499265 |
| Molecular Formula | C46H44IrN2OSi-2 |
| Molecular Weight | 866.20 g/mol |
| Exact Mass | 866.32 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-3-phenyl-3H-indole;[4-(1,1-dideuterio-2,2-dimethylpropyl)-6-phenyl-2-(trideuteriomethyl)-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | [2H]C([2H])([2H])c1nc(-c2[c-]cccc2)cc(C([2H])([2H])C(C)(C)C)c1[Si](C)(C)C.[Ir].[c-]1ccc2c(oc3ccccc32)c1C1=Nc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C26H16NO.C20H28NSi.Ir/c1-2-9-17(10-3-1)24-20-12-4-6-15-22(20)27-25(24)21-14-8-13-19-18-11-5-7-16-23(18)28-26(19)21;1-15-19(22(5,6)7)17(14-20(2,3)4)13-18(21-15)16-11-9-8-10-12-16;/h1-13,15-16,24H;8-11,13H,14H2,1-7H3;/q2*-1;/i;1D3,14D2; |
| InChIKey | BRBKIZWDWGGLGA-GOPXZUBQSA-N |
| XLogP | 11.64 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.20 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|