C39H43IrN3OSi-2 — CID 155611614
iridium;4-[5-methyl-4-(2-methylpropyl)-2-pyridinyl]-3H-[1]benzofuro[3,2-c]pyridin-3-ide;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 155611614) has the molecular formula C39H43IrN3OSi-2 and a molecular weight of 790.10 g/mol. Its IUPAC name is iridium;4-[5-methyl-4-(2-methylpropyl)-2-pyridinyl]-3H-[1]benzofuro[3,2-c]pyridin-3-ide;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | iridium;4-[5-methyl-4-(2-methylpropyl)-2-pyridinyl]-3H-[1]benzofuro[3,2-c]pyridin-3-ide;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 155611614 |
| Molecular Formula | C39H43IrN3OSi-2 |
| Molecular Weight | 790.10 g/mol |
| Exact Mass | 790.28 |
| IUPAC Name | iridium;4-[5-methyl-4-(2-methylpropyl)-2-pyridinyl]-3H-[1]benzofuro[3,2-c]pyridin-3-ide;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1cnc(-c2[c-]ncc3c2oc2ccccc23)cc1CC(C)C.[Ir] |
| InChI | InChI=1S/C21H19N2O.C18H24NSi.Ir/c1-13(2)8-15-9-19(23-10-14(15)3)18-12-22-11-17-16-6-4-5-7-20(16)24-21(17)18;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h4-7,9-11,13H,8H2,1-3H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | JBNZAPXJCXONCA-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.10 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|