C45H46IrN2OSi-2 — CID 166577515
iridium;4-(2-methylpropyl)-2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 166577515) has the molecular formula C45H46IrN2OSi-2 and a molecular weight of 851.18 g/mol. Its IUPAC name is iridium;4-(2-methylpropyl)-2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | iridium;4-(2-methylpropyl)-2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 166577515 |
| Molecular Formula | C45H46IrN2OSi-2 |
| Molecular Weight | 851.18 g/mol |
| Exact Mass | 851.30 |
| IUPAC Name | iridium;4-(2-methylpropyl)-2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CC(C)Cc1ccnc(-c2[c-]cc(-c3ccccc3)c3c2oc2ccccc23)c1.[Ir] |
| InChI | InChI=1S/C27H22NO.C18H24NSi.Ir/c1-18(2)16-19-14-15-28-24(17-19)22-13-12-21(20-8-4-3-5-9-20)26-23-10-6-7-11-25(23)29-27(22)26;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h3-12,14-15,17-18H,16H2,1-2H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | HLOYOTXKKGGUHH-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.18 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|