C46H40IrN2OSi-2 — CID 166576193
iridium;4-phenyl-2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane (PubChem CID 166576193) has the molecular formula C46H40IrN2OSi-2 and a molecular weight of 857.14 g/mol. Its IUPAC name is iridium;4-phenyl-2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane.
| Compound Name | iridium;4-phenyl-2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166576193 |
| Molecular Formula | C46H40IrN2OSi-2 |
| Molecular Weight | 857.14 g/mol |
| Exact Mass | 857.26 |
| IUPAC Name | iridium;4-phenyl-2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)pyridine;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
| SMILES | CC(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.[Ir].[c-]1cc(-c2ccccc2)c2c(oc3ccccc32)c1-c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C29H18NO.C17H22NSi.Ir/c1-3-9-20(10-4-1)22-17-18-30-26(19-22)24-16-15-23(21-11-5-2-6-12-21)28-25-13-7-8-14-27(25)31-29(24)28;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h1-15,17-19H;6-9,11-13H,1-5H3;/q2*-1; |
| InChIKey | XVFQWRDHDCSWAC-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.14 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|