C48H44IrN2OSi-2 — CID 171435976
iridium;2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)-4-(1-phenylethyl)pyridine;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane (PubChem CID 171435976) has the molecular formula C48H44IrN2OSi-2 and a molecular weight of 885.20 g/mol. Its IUPAC name is iridium;2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)-4-(1-phenylethyl)pyridine;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane.
| Compound Name | iridium;2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)-4-(1-phenylethyl)pyridine;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 171435976 |
| Molecular Formula | C48H44IrN2OSi-2 |
| Molecular Weight | 885.20 g/mol |
| Exact Mass | 885.29 |
| IUPAC Name | iridium;2-(1-phenyl-3H-dibenzofuran-3-id-4-yl)-4-(1-phenylethyl)pyridine;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
| SMILES | CC(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CC(c1ccccc1)c1ccnc(-c2[c-]cc(-c3ccccc3)c3c2oc2ccccc23)c1.[Ir] |
| InChI | InChI=1S/C31H22NO.C17H22NSi.Ir/c1-21(22-10-4-2-5-11-22)24-18-19-32-28(20-24)26-17-16-25(23-12-6-3-7-13-23)30-27-14-8-9-15-29(27)33-31(26)30;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h2-16,18-21H,1H3;6-9,11-13H,1-5H3;/q2*-1; |
| InChIKey | WCDYOOWNBRHVPM-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.20 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|