C36H26IrN2O-2 — CID 162707348
2-(3H-dibenzofuran-3-id-2-yl)-4-(1-phenylethyl)pyridine;iridium;2-phenylpyridine (PubChem CID 162707348) has the molecular formula C36H26IrN2O-2 and a molecular weight of 694.83 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-2-yl)-4-(1-phenylethyl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(3H-dibenzofuran-3-id-2-yl)-4-(1-phenylethyl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 162707348 |
| Molecular Formula | C36H26IrN2O-2 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 695.17 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-2-yl)-4-(1-phenylethyl)pyridine;iridium;2-phenylpyridine |
| SMILES | CC(c1ccccc1)c1ccnc(-c2[c-]cc3oc4ccccc4c3c2)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C25H18NO.C11H8N.Ir/c1-17(18-7-3-2-4-8-18)19-13-14-26-23(16-19)20-11-12-25-22(15-20)21-9-5-6-10-24(21)27-25;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-10,12-17H,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | QGINYWGASQUGKZ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|