C35H24IrN2O-2 — CID 59500159
2-(3H-dibenzofuran-3-id-2-yl)pyridine;iridium;4-methyl-5-phenyl-2-phenylpyridine (PubChem CID 59500159) has the molecular formula C35H24IrN2O-2 and a molecular weight of 680.81 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-2-yl)pyridine;iridium;4-methyl-5-phenyl-2-phenylpyridine.
| Compound Name | 2-(3H-dibenzofuran-3-id-2-yl)pyridine;iridium;4-methyl-5-phenyl-2-phenylpyridine |
|---|---|
| PubChem CID | 59500159 |
| Molecular Formula | C35H24IrN2O-2 |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 681.15 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-2-yl)pyridine;iridium;4-methyl-5-phenyl-2-phenylpyridine |
| SMILES | Cc1cc(-c2[c-]cccc2)ncc1-c1ccccc1.[Ir].[c-]1cc2oc3ccccc3c2cc1-c1ccccn1 |
| InChI | InChI=1S/C18H14N.C17H10NO.Ir/c1-14-12-18(16-10-6-3-7-11-16)19-13-17(14)15-8-4-2-5-9-15;1-2-7-16-13(5-1)14-11-12(8-9-17(14)19-16)15-6-3-4-10-18-15;/h2-10,12-13H,1H3;1-7,9-11H;/q2*-1; |
| InChIKey | ZDZIZPONQAKNCN-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|