C20H22IrNO2- — CID 58435106
iridium;methanol;4-methyl-5-phenyl-2-phenylpyridine (PubChem CID 58435106) has the molecular formula C20H22IrNO2- and a molecular weight of 500.62 g/mol. Its IUPAC name is iridium;methanol;4-methyl-5-phenyl-2-phenylpyridine.
| Compound Name | iridium;methanol;4-methyl-5-phenyl-2-phenylpyridine |
|---|---|
| PubChem CID | 58435106 |
| Molecular Formula | C20H22IrNO2- |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | iridium;methanol;4-methyl-5-phenyl-2-phenylpyridine |
| SMILES | CO.CO.Cc1cc(-c2[c-]cccc2)ncc1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C18H14N.2CH4O.Ir/c1-14-12-18(16-10-6-3-7-11-16)19-13-17(14)15-8-4-2-5-9-15;2*1-2;/h2-10,12-13H,1H3;2*2H,1H3;/q-1;;; |
| InChIKey | KBNNLSUZDFVAPU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|