C30H24IrN2-2 — CID 58435058
iridium;4-methyl-5-phenyl-2-phenylpyridine;2-methyl-6-phenylpyridine (PubChem CID 58435058) has the molecular formula C30H24IrN2-2 and a molecular weight of 604.75 g/mol. Its IUPAC name is iridium;4-methyl-5-phenyl-2-phenylpyridine;2-methyl-6-phenylpyridine.
| Compound Name | iridium;4-methyl-5-phenyl-2-phenylpyridine;2-methyl-6-phenylpyridine |
|---|---|
| PubChem CID | 58435058 |
| Molecular Formula | C30H24IrN2-2 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | iridium;4-methyl-5-phenyl-2-phenylpyridine;2-methyl-6-phenylpyridine |
| SMILES | Cc1cc(-c2[c-]cccc2)ncc1-c1ccccc1.Cc1cccc(-c2[c-]cccc2)n1.[Ir] |
| InChI | InChI=1S/C18H14N.C12H10N.Ir/c1-14-12-18(16-10-6-3-7-11-16)19-13-17(14)15-8-4-2-5-9-15;1-10-6-5-9-12(13-10)11-7-3-2-4-8-11;/h2-10,12-13H,1H3;2-7,9H,1H3;/q2*-1; |
| InChIKey | NWRGXBRKNFFSSB-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|