C43H36IrN3 — CID 59547058
iridium(3+);5-phenyl-2-phenyl-4-(2,2,2-trideuterioethyl)pyridine;bis(2-phenyl-6-(trideuteriomethyl)pyridine) (PubChem CID 59547058) has the molecular formula C43H36IrN3 and a molecular weight of 796.05 g/mol. Its IUPAC name is iridium(3+);5-phenyl-2-phenyl-4-(2,2,2-trideuterioethyl)pyridine;bis(2-phenyl-6-(trideuteriomethyl)pyridine).
| Compound Name | iridium(3+);5-phenyl-2-phenyl-4-(2,2,2-trideuterioethyl)pyridine;bis(2-phenyl-6-(trideuteriomethyl)pyridine) |
|---|---|
| PubChem CID | 59547058 |
| Molecular Formula | C43H36IrN3 |
| Molecular Weight | 796.05 g/mol |
| Exact Mass | 796.31 |
| IUPAC Name | iridium(3+);5-phenyl-2-phenyl-4-(2,2,2-trideuterioethyl)pyridine;bis(2-phenyl-6-(trideuteriomethyl)pyridine) |
| SMILES | [2H]C([2H])([2H])Cc1cc(-c2[c-]cccc2)ncc1-c1ccccc1.[2H]C([2H])([2H])c1cccc(-c2[c-]cccc2)n1.[2H]C([2H])([2H])c1cccc(-c2[c-]cccc2)n1.[Ir+3] |
| InChI | InChI=1S/C19H16N.2C12H10N.Ir/c1-2-15-13-19(17-11-7-4-8-12-17)20-14-18(15)16-9-5-3-6-10-16;2*1-10-6-5-9-12(13-10)11-7-3-2-4-8-11;/h3-11,13-14H,2H2,1H3;2*2-7,9H,1H3;/q3*-1;+3/i3*1D3; |
| InChIKey | JKMJURRWGHGXNS-AFSCPLLHSA-N |
| XLogP | 10.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.05 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|