C37H30IrN2-2 — CID 162707508
4-[dideuterio(phenyl)methyl]-2-phenyl-5-(trideuteriomethyl)pyridine;iridium;4-phenyl-2-phenyl-5-(trideuteriomethyl)pyridine (PubChem CID 162707508) has the molecular formula C37H30IrN2-2 and a molecular weight of 702.93 g/mol. Its IUPAC name is 4-[dideuterio(phenyl)methyl]-2-phenyl-5-(trideuteriomethyl)pyridine;iridium;4-phenyl-2-phenyl-5-(trideuteriomethyl)pyridine.
| Compound Name | 4-[dideuterio(phenyl)methyl]-2-phenyl-5-(trideuteriomethyl)pyridine;iridium;4-phenyl-2-phenyl-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 162707508 |
| Molecular Formula | C37H30IrN2-2 |
| Molecular Weight | 702.93 g/mol |
| Exact Mass | 703.26 |
| IUPAC Name | 4-[dideuterio(phenyl)methyl]-2-phenyl-5-(trideuteriomethyl)pyridine;iridium;4-phenyl-2-phenyl-5-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1-c1ccccc1.[2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1C([2H])([2H])c1ccccc1.[Ir] |
| InChI | InChI=1S/C19H16N.C18H14N.Ir/c1-15-14-20-19(17-10-6-3-7-11-17)13-18(15)12-16-8-4-2-5-9-16;1-14-13-19-18(16-10-6-3-7-11-16)12-17(14)15-8-4-2-5-9-15;/h2-10,13-14H,12H2,1H3;2-10,12-13H,1H3;/q2*-1;/i1D3,12D2;1D3; |
| InChIKey | DUQZTYDUDDXAQF-MENSMTKSSA-N |
| XLogP | 8.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.93 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|