C13H12FIrN-2 — CID 168794119
carbanide;4-fluoro-2-phenyl-5-(trideuteriomethyl)pyridine;iridium (PubChem CID 168794119) has the molecular formula C13H12FIrN-2 and a molecular weight of 396.48 g/mol. Its IUPAC name is carbanide;4-fluoro-2-phenyl-5-(trideuteriomethyl)pyridine;iridium.
| Compound Name | carbanide;4-fluoro-2-phenyl-5-(trideuteriomethyl)pyridine;iridium |
|---|---|
| PubChem CID | 168794119 |
| Molecular Formula | C13H12FIrN-2 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | carbanide;4-fluoro-2-phenyl-5-(trideuteriomethyl)pyridine;iridium |
| SMILES | [2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1F.[CH3-].[Ir] |
| InChI | InChI=1S/C12H9FN.CH3.Ir/c1-9-8-14-12(7-11(9)13)10-5-3-2-4-6-10;;/h2-5,7-8H,1H3;1H3;/q2*-1;/i1D3;; |
| InChIKey | UFSWJGODTGKCSV-GXXYEPOPSA-N |
| XLogP | 3.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|