C19H22IrN- — CID 140790056
iridium;5,5,8,8-tetramethyl-3-phenyl-6,7-dihydroisoquinoline (PubChem CID 140790056) has the molecular formula C19H22IrN- and a molecular weight of 456.61 g/mol. Its IUPAC name is iridium;5,5,8,8-tetramethyl-3-phenyl-6,7-dihydroisoquinoline.
| Compound Name | iridium;5,5,8,8-tetramethyl-3-phenyl-6,7-dihydroisoquinoline |
|---|---|
| PubChem CID | 140790056 |
| Molecular Formula | C19H22IrN- |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | iridium;5,5,8,8-tetramethyl-3-phenyl-6,7-dihydroisoquinoline |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3[c-]cccc3)ncc21.[Ir] |
| InChI | InChI=1S/C19H22N.Ir/c1-18(2)10-11-19(3,4)16-13-20-17(12-15(16)18)14-8-6-5-7-9-14;/h5-8,12-13H,10-11H2,1-4H3;/q-1; |
| InChIKey | WHKCTKPNXYCDHT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|