C15H18GeIrN- — CID 166574327
iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane (PubChem CID 166574327) has the molecular formula C15H18GeIrN- and a molecular weight of 477.14 g/mol. Its IUPAC name is iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane.
| Compound Name | iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 166574327 |
| Molecular Formula | C15H18GeIrN- |
| Molecular Weight | 477.14 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | iridium;trimethyl-(4-methyl-6-phenyl-3-pyridinyl)germane |
| SMILES | Cc1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir] |
| InChI | InChI=1S/C15H18GeN.Ir/c1-12-10-15(13-8-6-5-7-9-13)17-11-14(12)16(2,3)4;/h5-8,10-11H,1-4H3;/q-1; |
| InChIKey | ZQMASSUYMOIVBF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|