C17H22GeIrN- — CID 166499170
iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)germane (PubChem CID 166499170) has the molecular formula C17H22GeIrN- and a molecular weight of 505.20 g/mol. Its IUPAC name is iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)germane.
| Compound Name | iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 166499170 |
| Molecular Formula | C17H22GeIrN- |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)germane |
| SMILES | CC(C)c1cc(-c2[c-]cccc2)ncc1[Ge](C)(C)C.[Ir] |
| InChI | InChI=1S/C17H22GeN.Ir/c1-13(2)15-11-17(14-9-7-6-8-10-14)19-12-16(15)18(3,4)5;/h6-9,11-13H,1-5H3;/q-1; |
| InChIKey | GBFFXYGYKATNHK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|