C14H16IrNP — CID 59782046
iridium;trimethyl-(2-phenyl-4-pyridinyl)phosphanium (PubChem CID 59782046) has the molecular formula C14H16IrNP and a molecular weight of 421.48 g/mol. Its IUPAC name is iridium;trimethyl-(2-phenyl-4-pyridinyl)phosphanium.
| Compound Name | iridium;trimethyl-(2-phenyl-4-pyridinyl)phosphanium |
|---|---|
| PubChem CID | 59782046 |
| Molecular Formula | C14H16IrNP |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | iridium;trimethyl-(2-phenyl-4-pyridinyl)phosphanium |
| SMILES | C[P+](C)(C)c1ccnc(-c2[c-]cccc2)c1.[Ir] |
| InChI | InChI=1S/C14H16NP.Ir/c1-16(2,3)13-9-10-15-14(11-13)12-7-5-4-6-8-12;/h4-7,9-11H,1-3H3; |
| InChIKey | HADZYOVOEMQLEK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|