C31H24IrN — CID 162487319
4-(3,5-dimethylphenyl)-2-phenylpyridine;iridium(3+);phenylbenzene (PubChem CID 162487319) has the molecular formula C31H24IrN and a molecular weight of 602.76 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-2-phenylpyridine;iridium(3+);phenylbenzene.
| Compound Name | 4-(3,5-dimethylphenyl)-2-phenylpyridine;iridium(3+);phenylbenzene |
|---|---|
| PubChem CID | 162487319 |
| Molecular Formula | C31H24IrN |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-2-phenylpyridine;iridium(3+);phenylbenzene |
| SMILES | Cc1cc(C)cc(-c2ccnc(-c3[c-]cccc3)c2)c1.[Ir+3].[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C19H16N.C12H8.Ir/c1-14-10-15(2)12-18(11-14)17-8-9-20-19(13-17)16-6-4-3-5-7-16;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h3-6,8-13H,1-2H3;1-7,9H;/q-1;-2;+3 |
| InChIKey | ZNEWJVQSPUJTCF-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|