C31H20IrNO2- — CID 164802657
4-(5,19-dimethyl-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaen-2-yl)-2-phenylpyridine;iridium (PubChem CID 164802657) has the molecular formula C31H20IrNO2- and a molecular weight of 630.72 g/mol. Its IUPAC name is 4-(5,19-dimethyl-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaen-2-yl)-2-phenylpyridine;iridium.
| Compound Name | 4-(5,19-dimethyl-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaen-2-yl)-2-phenylpyridine;iridium |
|---|---|
| PubChem CID | 164802657 |
| Molecular Formula | C31H20IrNO2- |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 631.11 |
| IUPAC Name | 4-(5,19-dimethyl-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaen-2-yl)-2-phenylpyridine;iridium |
| SMILES | Cc1cccc2oc3cc4oc5cccc(C)c5c4c(-c4ccnc(-c5[c-]cccc5)c4)c3c12.[Ir] |
| InChI | InChI=1S/C31H20NO2.Ir/c1-18-8-6-12-23-27(18)30-25(33-23)17-26-31(28-19(2)9-7-13-24(28)34-26)29(30)21-14-15-32-22(16-21)20-10-4-3-5-11-20;/h3-10,12-17H,1-2H3;/q-1; |
| InChIKey | KGMMUHDZIRRAMP-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|