C29H16IrNS2- — CID 164802773
4-(10,14-dithiapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaen-2-yl)-2-phenylpyridine;iridium (PubChem CID 164802773) has the molecular formula C29H16IrNS2- and a molecular weight of 634.81 g/mol. Its IUPAC name is 4-(10,14-dithiapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaen-2-yl)-2-phenylpyridine;iridium.
| Compound Name | 4-(10,14-dithiapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaen-2-yl)-2-phenylpyridine;iridium |
|---|---|
| PubChem CID | 164802773 |
| Molecular Formula | C29H16IrNS2- |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 635.04 |
| IUPAC Name | 4-(10,14-dithiapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(13),2,4,6,8,11,15,17,19-nonaen-2-yl)-2-phenylpyridine;iridium |
| SMILES | [Ir].[c-]1ccccc1-c1cc(-c2c3c(cc4sc5ccccc5c24)sc2ccccc23)ccn1 |
| InChI | InChI=1S/C29H16NS2.Ir/c1-2-8-18(9-3-1)22-16-19(14-15-30-22)27-28-20-10-4-6-12-23(20)31-25(28)17-26-29(27)21-11-5-7-13-24(21)32-26;/h1-8,10-17H;/q-1; |
| InChIKey | KYJYTKQQKQSPOS-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|