About CID 164803355
CID 164803355 (PubChem CID 164803355) has the molecular formula C40H23IrN3S-2
and a molecular weight of 769.93 g/mol.
Molecular Properties
| Compound Name | CID 164803355 |
| PubChem CID | 164803355 |
| Molecular Formula | C40H23IrN3S-2 |
| Molecular Weight | 769.93 g/mol |
| Exact Mass | 770.13 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1cc2c(cc1-c1ccccn1)c1cccc3c4ccc5sc6ccccc6c5c4n2c13.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C29H15N2S.C11H8N.Ir/c1-2-10-25-21(6-1)27-26(32-25)14-12-20-18-7-5-8-19-22-16-17(23-9-3-4-15-30-23)11-13-24(22)31(28(18)19)29(20)27;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-10,12-16H;1-6,8-9H;/q2*-1; |
| InChIKey | BUMLJJNTYDSDAH-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 769.93 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 164803355 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164803355?
The IUPAC name of CID 164803355 (CID 164803355) is not available.
What is the SMILES notation for CID 164803355?
The canonical SMILES for CID 164803355 is [Ir].[c-]1cc2c(cc1-c1ccccn1)c1cccc3c4ccc5sc6ccccc6c5c4n2c13.[c-]1ccccc1-c1ccccn1.
What is the InChIKey of CID 164803355?
The InChIKey is BUMLJJNTYDSDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H15N2S.C11H8N.Ir/c1-2-10-25-21(6-1)27-26(32-25)14-12-20-18-7-5-8-19-22-16-17(23-9-3-4-15-30-23)11-13-24(22)31(28(18)19)29(20)27;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-10,12-16H;1-6,8-9H;/q2*-1;.
What are the key properties of CID 164803355?
CID 164803355 has a molecular weight of 769.93 g/mol, XLogP of 10.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164803355 is sourced from PubChem (CID 164803355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).