C44H31IrN3S-2 — CID 164803437
CID 164803437 (PubChem CID 164803437) has the molecular formula C44H31IrN3S-2 and a molecular weight of 826.04 g/mol.
| Compound Name | CID 164803437 |
|---|---|
| PubChem CID | 164803437 |
| Molecular Formula | C44H31IrN3S-2 |
| Molecular Weight | 826.04 g/mol |
| Exact Mass | 826.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cc3c(c2)c2cccc4c5cc6c(cc5n3c24)sc2ccccc26)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C33H23N2S.C11H8N.Ir/c1-33(2,3)20-13-14-34-27(16-20)19-11-12-28-24(15-19)22-8-6-9-23-25-17-26-21-7-4-5-10-30(21)36-31(26)18-29(25)35(28)32(22)23;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-10,12-18H,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | VGYJJBKNYHNOSJ-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.04 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|